C9H18F3N3O2S2 — CID 106433776
2-(aminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide (PubChem CID 106433776) has the molecular formula C9H18F3N3O2S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106433776 |
| Molecular Formula | C9H18F3N3O2S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O2S2/c10-9(11,12)18-6-4-14-19(16,17)15-5-2-1-3-8(15)7-13/h8,14H,1-7,13H2 |
| InChIKey | ROKPUCOCPYELJI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|