C11H25N3O2S — CID 106058322
2-(aminomethyl)-N-pentylpiperidine-1-sulfonamide (PubChem CID 106058322) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N-pentylpiperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-pentylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106058322 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(aminomethyl)-N-pentylpiperidine-1-sulfonamide |
| SMILES | CCCCCNS(=O)(=O)N1CCCCC1CN |
| InChI | InChI=1S/C11H25N3O2S/c1-2-3-5-8-13-17(15,16)14-9-6-4-7-11(14)10-12/h11,13H,2-10,12H2,1H3 |
| InChIKey | ZOQCLLYAMNNPMU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|