C11H22N2O4S — CID 60857759
1-(pentylsulfamoyl)piperidine-2-carboxylic acid (PubChem CID 60857759) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(pentylsulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(pentylsulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 60857759 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(pentylsulfamoyl)piperidine-2-carboxylic acid |
| SMILES | CCCCCNS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C11H22N2O4S/c1-2-3-5-8-12-18(16,17)13-9-6-4-7-10(13)11(14)15/h10,12H,2-9H2,1H3,(H,14,15) |
| InChIKey | DUWHDKDDLLXZFW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|