C9H18N2O6S2 — CID 54931954
1-(2-methylsulfonylethylsulfamoyl)piperidine-2-carboxylic acid (PubChem CID 54931954) has the molecular formula C9H18N2O6S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(2-methylsulfonylethylsulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54931954 |
| Molecular Formula | C9H18N2O6S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfamoyl)piperidine-2-carboxylic acid |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C9H18N2O6S2/c1-18(14,15)7-5-10-19(16,17)11-6-3-2-4-8(11)9(12)13/h8,10H,2-7H2,1H3,(H,12,13) |
| InChIKey | QGFCLXNWFWKRGX-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |