C10H19N3O5S — CID 60857946
1-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 60857946) has the molecular formula C10H19N3O5S and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 60857946 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | CN(C)C(=O)CNS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C10H19N3O5S/c1-12(2)9(14)7-11-19(17,18)13-6-4-3-5-8(13)10(15)16/h8,11H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | HLZSATWCYRTWLR-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |