C12H24N2O6S — CID 79538538
1-(2,2-diethoxyethylsulfamoyl)piperidine-2-carboxylic acid (PubChem CID 79538538) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-(2,2-diethoxyethylsulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(2,2-diethoxyethylsulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79538538 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-(2,2-diethoxyethylsulfamoyl)piperidine-2-carboxylic acid |
| SMILES | CCOC(CNS(=O)(=O)N1CCCCC1C(=O)O)OCC |
| InChI | InChI=1S/C12H24N2O6S/c1-3-19-11(20-4-2)9-13-21(17,18)14-8-6-5-7-10(14)12(15)16/h10-11,13H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | FUFTUDVGTIYZBO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|