C7H14N2O5S — CID 64974074
1-(methoxysulfamoyl)piperidine-2-carboxylic acid (PubChem CID 64974074) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is 1-(methoxysulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(methoxysulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 64974074 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(methoxysulfamoyl)piperidine-2-carboxylic acid |
| SMILES | CONS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C7H14N2O5S/c1-14-8-15(12,13)9-5-3-2-4-6(9)7(10)11/h6,8H,2-5H2,1H3,(H,10,11) |
| InChIKey | XXXKCDLKYGVFRD-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|