C7H11N3O4S — CID 79194973
1-(cyanosulfamoyl)piperidine-2-carboxylic acid (PubChem CID 79194973) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is 1-(cyanosulfamoyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(cyanosulfamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79194973 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-(cyanosulfamoyl)piperidine-2-carboxylic acid |
| SMILES | N#CNS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C7H11N3O4S/c8-5-9-15(13,14)10-4-2-1-3-6(10)7(11)12/h6,9H,1-4H2,(H,11,12) |
| InChIKey | RRUCTEWHRPLEEB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|