C10H14N4O4S — CID 60857593
1-[bis(cyanomethyl)sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 60857593) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-[bis(cyanomethyl)sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[bis(cyanomethyl)sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 60857593 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-[bis(cyanomethyl)sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | N#CCN(CC#N)S(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C10H14N4O4S/c11-4-7-13(8-5-12)19(17,18)14-6-2-1-3-9(14)10(15)16/h9H,1-3,6-8H2,(H,15,16) |
| InChIKey | AGQYQDRYWIVDPG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|