C10H17N3O4S — CID 122069672
(2R)-1-[2-cyanoethyl(ethyl)sulfamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 122069672) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2R)-1-[2-cyanoethyl(ethyl)sulfamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-cyanoethyl(ethyl)sulfamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122069672 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2R)-1-[2-cyanoethyl(ethyl)sulfamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCN(CCC#N)S(=O)(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H17N3O4S/c1-2-12(7-4-6-11)18(16,17)13-8-3-5-9(13)10(14)15/h9H,2-5,7-8H2,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | QTCMENDKOVBKMI-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |