C12H22N2O6S — CID 61009034
3-[(2-ethoxycarbonylpyrrolidin-1-yl)sulfonyl-ethylamino]propanoic acid (PubChem CID 61009034) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is 3-[(2-ethoxycarbonylpyrrolidin-1-yl)sulfonyl-ethylamino]propanoic acid.
| Compound Name | 3-[(2-ethoxycarbonylpyrrolidin-1-yl)sulfonyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61009034 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[(2-ethoxycarbonylpyrrolidin-1-yl)sulfonyl-ethylamino]propanoic acid |
| SMILES | CCOC(=O)C1CCCN1S(=O)(=O)N(CC)CCC(=O)O |
| InChI | InChI=1S/C12H22N2O6S/c1-3-13(9-7-11(15)16)21(18,19)14-8-5-6-10(14)12(17)20-4-2/h10H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | XWGCERNWZGFNGP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |