C11H21N3O5S — CID 60858940
1-[ethyl-[2-(methylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 60858940) has the molecular formula C11H21N3O5S and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-[ethyl-[2-(methylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[ethyl-[2-(methylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 60858940 |
| Molecular Formula | C11H21N3O5S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[ethyl-[2-(methylamino)-2-oxoethyl]sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | CCN(CC(=O)NC)S(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C11H21N3O5S/c1-3-13(8-10(15)12-2)20(18,19)14-7-5-4-6-9(14)11(16)17/h9H,3-8H2,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | RSLMGORLTSQPEF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |