C12H26N2O4S — CID 79547905
N-(2,2-diethoxyethyl)-2-methylpiperidine-1-sulfonamide (PubChem CID 79547905) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2,2-diethoxyethyl)-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 79547905 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(2,2-diethoxyethyl)-2-methylpiperidine-1-sulfonamide |
| SMILES | CCOC(CNS(=O)(=O)N1CCCCC1C)OCC |
| InChI | InChI=1S/C12H26N2O4S/c1-4-17-12(18-5-2)10-13-19(15,16)14-9-7-6-8-11(14)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | NANJDRKFLTVIKE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|