C11H22N2O6S2 — CID 79561600
1-[(2-methyl-2-methylsulfonylpropyl)sulfamoyl]piperidine-2-carboxylic acid (PubChem CID 79561600) has the molecular formula C11H22N2O6S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(2-methyl-2-methylsulfonylpropyl)sulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-methyl-2-methylsulfonylpropyl)sulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79561600 |
| Molecular Formula | C11H22N2O6S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-[(2-methyl-2-methylsulfonylpropyl)sulfamoyl]piperidine-2-carboxylic acid |
| SMILES | CC(C)(CNS(=O)(=O)N1CCCCC1C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O6S2/c1-11(2,20(3,16)17)8-12-21(18,19)13-7-5-4-6-9(13)10(14)15/h9,12H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | YXVZWLZWNNNRIJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |