C12H23NO6S2 — CID 122070160
1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 122070160) has the molecular formula C12H23NO6S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122070160 |
| Molecular Formula | C12H23NO6S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(3-methyl-3-methylsulfonylbutyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | CC(C)(CCS(=O)(=O)N1CCCCC1C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C12H23NO6S2/c1-12(2,20(3,16)17)7-9-21(18,19)13-8-5-4-6-10(13)11(14)15/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | PCMZQKGULIPAQY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |