C16H31NO4S2 — CID 166282263
4a-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonyl-2,3,4,5,6,7,8,8a-octahydroquinoline (PubChem CID 166282263) has the molecular formula C16H31NO4S2 and a molecular weight of 365.56 g/mol. Its IUPAC name is 4a-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonyl-2,3,4,5,6,7,8,8a-octahydroquinoline.
| Compound Name | 4a-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonyl-2,3,4,5,6,7,8,8a-octahydroquinoline |
|---|---|
| PubChem CID | 166282263 |
| Molecular Formula | C16H31NO4S2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4a-methyl-1-(3-methyl-3-methylsulfonylbutyl)sulfonyl-2,3,4,5,6,7,8,8a-octahydroquinoline |
| SMILES | CC12CCCCC1N(S(=O)(=O)CCC(C)(C)S(C)(=O)=O)CCC2 |
| InChI | InChI=1S/C16H31NO4S2/c1-15(2,22(4,18)19)11-13-23(20,21)17-12-7-10-16(3)9-6-5-8-14(16)17/h14H,5-13H2,1-4H3 |
| InChIKey | PYZITPPLOCVGEZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |