C13H23NO6S — CID 122070228
1-(6-methoxy-6-oxohexyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 122070228) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(6-methoxy-6-oxohexyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(6-methoxy-6-oxohexyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122070228 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-(6-methoxy-6-oxohexyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | COC(=O)CCCCCS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C13H23NO6S/c1-20-12(15)8-3-2-6-10-21(18,19)14-9-5-4-7-11(14)13(16)17/h11H,2-10H2,1H3,(H,16,17) |
| InChIKey | ILRIQEWOJSETGV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|