C10H16N2O7S — CID 107435343
1-(4-methoxy-4-oxobutyl)sulfonyl-5-oxopiperazine-2-carboxylic acid (PubChem CID 107435343) has the molecular formula C10H16N2O7S and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-(4-methoxy-4-oxobutyl)sulfonyl-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(4-methoxy-4-oxobutyl)sulfonyl-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107435343 |
| Molecular Formula | C10H16N2O7S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-(4-methoxy-4-oxobutyl)sulfonyl-5-oxopiperazine-2-carboxylic acid |
| SMILES | COC(=O)CCCS(=O)(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C10H16N2O7S/c1-19-9(14)3-2-4-20(17,18)12-6-8(13)11-5-7(12)10(15)16/h7H,2-6H2,1H3,(H,11,13)(H,15,16) |
| InChIKey | OPLJIDVHVZAEPH-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |