C5H9N3O5S — CID 107435429
5-oxo-1-sulfamoylpiperazine-2-carboxylic acid (PubChem CID 107435429) has the molecular formula C5H9N3O5S and a molecular weight of 223.21 g/mol. Its IUPAC name is 5-oxo-1-sulfamoylpiperazine-2-carboxylic acid.
| Compound Name | 5-oxo-1-sulfamoylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107435429 |
| Molecular Formula | C5H9N3O5S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-oxo-1-sulfamoylpiperazine-2-carboxylic acid |
| SMILES | NS(=O)(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C5H9N3O5S/c6-14(12,13)8-2-4(9)7-1-3(8)5(10)11/h3H,1-2H2,(H,7,9)(H,10,11)(H2,6,12,13) |
| InChIKey | IQOZRFVHLFDEGG-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |