C12H21N3O5S — CID 107435221
1-[cyclohexyl(methyl)sulfamoyl]-5-oxopiperazine-2-carboxylic acid (PubChem CID 107435221) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)sulfamoyl]-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-[cyclohexyl(methyl)sulfamoyl]-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107435221 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[cyclohexyl(methyl)sulfamoyl]-5-oxopiperazine-2-carboxylic acid |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C12H21N3O5S/c1-14(9-5-3-2-4-6-9)21(19,20)15-8-11(16)13-7-10(15)12(17)18/h9-10H,2-8H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | OHFNOGWEPLPERV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |