C11H20N2O5S — CID 107435546
1-(3,3-dimethylbutylsulfonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107435546) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(3,3-dimethylbutylsulfonyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(3,3-dimethylbutylsulfonyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107435546 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(3,3-dimethylbutylsulfonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C11H20N2O5S/c1-11(2,3)4-5-19(17,18)13-7-9(14)12-6-8(13)10(15)16/h8H,4-7H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | QBUZUEOUTNESCD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |