C9H18N4O5S — CID 83116927
1-[2-(carbamoylamino)ethylsulfamoyl]piperidine-2-carboxylic acid (PubChem CID 83116927) has the molecular formula C9H18N4O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)ethylsulfamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(carbamoylamino)ethylsulfamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83116927 |
| Molecular Formula | C9H18N4O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[2-(carbamoylamino)ethylsulfamoyl]piperidine-2-carboxylic acid |
| SMILES | NC(=O)NCCNS(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C9H18N4O5S/c10-9(16)11-4-5-12-19(17,18)13-6-2-1-3-7(13)8(14)15/h7,12H,1-6H2,(H,14,15)(H3,10,11,16) |
| InChIKey | SNNCICFDYBWRSX-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|