C20H36NO2+ — CID 27532172
[(2R)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-trimethylazanium (PubChem CID 27532172) has the molecular formula C20H36NO2+ and a molecular weight of 322.51 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-trimethylazanium.
| Compound Name | [(2R)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 27532172 |
| Molecular Formula | C20H36NO2+ |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | [(2R)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-trimethylazanium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC[C@H](O)C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C20H36NO2/c1-19(2,3)15-20(4,5)16-9-11-18(12-10-16)23-14-17(22)13-21(6,7)8/h9-12,17,22H,13-15H2,1-8H3/q+1/t17-/m1/s1 |
| InChIKey | ZOQHJZQAVQOOPB-QGZVFWFLSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|