C27H46NO2+ — CID 124768194
(R)-cyclohexyl-[(2S)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-methyl-prop-2-enylazanium (PubChem CID 124768194) has the molecular formula C27H46NO2+ and a molecular weight of 416.67 g/mol. Its IUPAC name is (R)-cyclohexyl-[(2S)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-methyl-prop-2-enylazanium.
| Compound Name | (R)-cyclohexyl-[(2S)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-methyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 124768194 |
| Molecular Formula | C27H46NO2+ |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | (R)-cyclohexyl-[(2S)-2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-methyl-prop-2-enylazanium |
| SMILES | C=CC[N@+](C)(C[C@H](O)COc1ccc(C(C)(C)CC(C)(C)C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H46NO2/c1-8-18-28(7,23-12-10-9-11-13-23)19-24(29)20-30-25-16-14-22(15-17-25)27(5,6)21-26(2,3)4/h8,14-17,23-24,29H,1,9-13,18-21H2,2-7H3/q+1/t24-,28+/m0/s1 |
| InChIKey | GETBUQMZUFEKDG-RBJSKKJNSA-N |
| XLogP | 6.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|