C23H36N2O4 — CID 42942556
3-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-5-propylimidazolidine-2,4-dione (PubChem CID 42942556) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42942556 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 3-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(CC(O)COc2ccc(C(C)(C)CC(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C23H36N2O4/c1-7-8-19-20(27)25(21(28)24-19)13-17(26)14-29-18-11-9-16(10-12-18)23(5,6)15-22(2,3)4/h9-12,17,19,26H,7-8,13-15H2,1-6H3,(H,24,28) |
| InChIKey | OSVJXWDUASBJFA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|