C16H21ClN2O4 — CID 31570548
(5S)-3-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 31570548) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is (5S)-3-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31570548 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (5S)-3-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)N(C[C@@H](O)COc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H21ClN2O4/c1-10(2)7-14-15(21)19(16(22)18-14)8-12(20)9-23-13-5-3-11(17)4-6-13/h3-6,10,12,14,20H,7-9H2,1-2H3,(H,18,22)/t12-,14+/m1/s1 |
| InChIKey | CXRMUATUAHEOLY-OCCSQVGLSA-N |
| XLogP | 2.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|