C20H22N2O5 — CID 17489169
5-benzyl-3-[2-hydroxy-3-(4-methoxyphenoxy)propyl]imidazolidine-2,4-dione (PubChem CID 17489169) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-benzyl-3-[2-hydroxy-3-(4-methoxyphenoxy)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[2-hydroxy-3-(4-methoxyphenoxy)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17489169 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-benzyl-3-[2-hydroxy-3-(4-methoxyphenoxy)propyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(OCC(O)CN2C(=O)NC(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-26-16-7-9-17(10-8-16)27-13-15(23)12-22-19(24)18(21-20(22)25)11-14-5-3-2-4-6-14/h2-10,15,18,23H,11-13H2,1H3,(H,21,25) |
| InChIKey | KUBIHSKQJYMNPN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|