C19H17N3O3 — CID 40812409
4-[2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile (PubChem CID 40812409) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 40812409 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-[2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCN2C(=O)N[C@H](Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3/c20-13-15-6-8-16(9-7-15)25-11-10-22-18(23)17(21-19(22)24)12-14-4-2-1-3-5-14/h1-9,17H,10-12H2,(H,21,24)/t17-/m1/s1 |
| InChIKey | RVDSBEPBGDXILJ-QGZVFWFLSA-N |
| XLogP | 2.10 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|