C19H14N2O3 — CID 100919085
4-[4-[2-(2,5-dioxopyrrol-1-yl)ethoxy]phenyl]benzonitrile (PubChem CID 100919085) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-[4-[2-(2,5-dioxopyrrol-1-yl)ethoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(2,5-dioxopyrrol-1-yl)ethoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 100919085 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[4-[2-(2,5-dioxopyrrol-1-yl)ethoxy]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OCCN3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C19H14N2O3/c20-13-14-1-3-15(4-2-14)16-5-7-17(8-6-16)24-12-11-21-18(22)9-10-19(21)23/h1-10H,11-12H2 |
| InChIKey | FMIPLJSLWBGHCM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|