C18H18N4O4 — CID 32828588
4-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]benzonitrile (PubChem CID 32828588) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 32828588 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]benzonitrile |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCOc2ccc(C#N)cc2)c1=O |
| InChI | InChI=1S/C18H18N4O4/c1-3-9-20-16(23)21(10-4-2)18(25)22(17(20)24)11-12-26-15-7-5-14(13-19)6-8-15/h3-8H,1-2,9-12H2 |
| InChIKey | FLXMEFCUIHRZDY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|