C12H10FNO3 — CID 82116529
1-[2-(4-fluorophenoxy)ethyl]pyrrole-2,5-dione (PubChem CID 82116529) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 82116529 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C12H10FNO3/c13-9-1-3-10(4-2-9)17-8-7-14-11(15)5-6-12(14)16/h1-6H,7-8H2 |
| InChIKey | UFVSOJBQROTQBF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|