C14H16FNO — CID 82082756
1-[2-(4-fluorophenoxy)ethyl]-2,5-dimethylpyrrole (PubChem CID 82082756) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-2,5-dimethylpyrrole.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 82082756 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNO/c1-11-3-4-12(2)16(11)9-10-17-14-7-5-13(15)6-8-14/h3-8H,9-10H2,1-2H3 |
| InChIKey | CMEXNKQFTPEQNM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |