C14H15NO3 — CID 94266003
1-[2-(2-ethylphenoxy)ethyl]pyrrole-2,5-dione (PubChem CID 94266003) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-[2-(2-ethylphenoxy)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(2-ethylphenoxy)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 94266003 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-[2-(2-ethylphenoxy)ethyl]pyrrole-2,5-dione |
| SMILES | CCc1ccccc1OCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H15NO3/c1-2-11-5-3-4-6-12(11)18-10-9-15-13(16)7-8-14(15)17/h3-8H,2,9-10H2,1H3 |
| InChIKey | JDIMPTFGNZSAPX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|