C13H12BrNO3 — CID 94719132
1-[3-(2-bromophenoxy)propyl]pyrrole-2,5-dione (PubChem CID 94719132) has the molecular formula C13H12BrNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is 1-[3-(2-bromophenoxy)propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2-bromophenoxy)propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 94719132 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 1-[3-(2-bromophenoxy)propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCOc1ccccc1Br |
| InChI | InChI=1S/C13H12BrNO3/c14-10-4-1-2-5-11(10)18-9-3-8-15-12(16)6-7-13(15)17/h1-2,4-7H,3,8-9H2 |
| InChIKey | VRAFJFPZUSWKPQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|