C18H26N2O4 — CID 31570526
(5R)-3-[(2R)-3-(4-ethylphenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 31570526) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (5R)-3-[(2R)-3-(4-ethylphenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2R)-3-(4-ethylphenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31570526 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (5R)-3-[(2R)-3-(4-ethylphenoxy)-2-hydroxypropyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CCc1ccc(OC[C@H](O)CN2C(=O)N[C@H](CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-4-13-5-7-15(8-6-13)24-11-14(21)10-20-17(22)16(9-12(2)3)19-18(20)23/h5-8,12,14,16,21H,4,9-11H2,1-3H3,(H,19,23)/t14-,16-/m1/s1 |
| InChIKey | SQOBXLLBHYRBEK-GDBMZVCRSA-N |
| XLogP | 1.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|