C19H24N2O4 — CID 100632219
(5S)-3-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-5-prop-2-ynylimidazolidine-2,4-dione (PubChem CID 100632219) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (5S)-3-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-5-prop-2-ynylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-5-prop-2-ynylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 100632219 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (5S)-3-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-5-prop-2-ynylimidazolidine-2,4-dione |
| SMILES | C#CC[C@@H]1NC(=O)N(C[C@H](O)COc2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-5-6-16-17(23)21(18(24)20-16)11-14(22)12-25-15-9-7-13(8-10-15)19(2,3)4/h1,7-10,14,16,22H,6,11-12H2,2-4H3,(H,20,24)/t14-,16-/m0/s1 |
| InChIKey | CECSTOWFJBUUTO-HOCLYGCPSA-N |
| XLogP | 1.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|