C21H38NO2+ — CID 43842249
ethyl-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-dimethylazanium (PubChem CID 43842249) has the molecular formula C21H38NO2+ and a molecular weight of 336.54 g/mol. Its IUPAC name is ethyl-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-dimethylazanium.
| Compound Name | ethyl-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 43842249 |
| Molecular Formula | C21H38NO2+ |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | ethyl-[2-hydroxy-3-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]propyl]-dimethylazanium |
| SMILES | CC[N+](C)(C)CC(O)COc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H38NO2/c1-9-22(7,8)14-18(23)15-24-19-12-10-17(11-13-19)21(5,6)16-20(2,3)4/h10-13,18,23H,9,14-16H2,1-8H3/q+1 |
| InChIKey | URHWABGLMQYBND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|