C33H52NO3+ — CID 124768456
(R)-benzyl-cyclohexyl-[(2R)-2-hydroxy-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propyl]-methylazanium (PubChem CID 124768456) has the molecular formula C33H52NO3+ and a molecular weight of 510.78 g/mol. Its IUPAC name is (R)-benzyl-cyclohexyl-[(2R)-2-hydroxy-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propyl]-methylazanium.
| Compound Name | (R)-benzyl-cyclohexyl-[(2R)-2-hydroxy-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propyl]-methylazanium |
|---|---|
| PubChem CID | 124768456 |
| Molecular Formula | C33H52NO3+ |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | (R)-benzyl-cyclohexyl-[(2R)-2-hydroxy-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propyl]-methylazanium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOC[C@H](O)C[N@@+](C)(Cc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C33H52NO3/c1-32(2,3)26-33(4,5)28-17-19-31(20-18-28)37-22-21-36-25-30(35)24-34(6,29-15-11-8-12-16-29)23-27-13-9-7-10-14-27/h7,9-10,13-14,17-20,29-30,35H,8,11-12,15-16,21-26H2,1-6H3/q+1/t30-,34-/m1/s1 |
| InChIKey | PRONGAWLQZADHF-KAODMTDESA-N |
| XLogP | 7.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|