C24H42NO3+ — CID 100798282
(2S)-1-(1-methylpyrrolidin-1-ium-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol (PubChem CID 100798282) has the molecular formula C24H42NO3+ and a molecular weight of 392.60 g/mol. Its IUPAC name is (2S)-1-(1-methylpyrrolidin-1-ium-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol.
| Compound Name | (2S)-1-(1-methylpyrrolidin-1-ium-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 100798282 |
| Molecular Formula | C24H42NO3+ |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | (2S)-1-(1-methylpyrrolidin-1-ium-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOC[C@@H](O)C[N+]2(C)CCCC2)cc1 |
| InChI | InChI=1S/C24H42NO3/c1-23(2,3)19-24(4,5)20-9-11-22(12-10-20)28-16-15-27-18-21(26)17-25(6)13-7-8-14-25/h9-12,21,26H,7-8,13-19H2,1-6H3/q+1/t21-/m0/s1 |
| InChIKey | NUIQDIJULDUKBP-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|