C30H46N2O4 — CID 100798354
(2R)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol (PubChem CID 100798354) has the molecular formula C30H46N2O4 and a molecular weight of 498.71 g/mol. Its IUPAC name is (2R)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 100798354 |
| Molecular Formula | C30H46N2O4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | (2R)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
| SMILES | COc1ccccc1N1CCN(C[C@@H](O)COCCOc2ccc(C(C)(C)CC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C30H46N2O4/c1-29(2,3)23-30(4,5)24-11-13-26(14-12-24)36-20-19-35-22-25(33)21-31-15-17-32(18-16-31)27-9-7-8-10-28(27)34-6/h7-14,25,33H,15-23H2,1-6H3/t25-/m1/s1 |
| InChIKey | SOKMPDYFAWNQAY-RUZDIDTESA-N |
| XLogP | 4.99 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|