C30H46N2O3 — CID 91670379
1-(4-benzylpiperazin-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol (PubChem CID 91670379) has the molecular formula C30H46N2O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 91670379 |
| Molecular Formula | C30H46N2O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-ol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC(O)CN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H46N2O3/c1-29(2,3)24-30(4,5)26-11-13-28(14-12-26)35-20-19-34-23-27(33)22-32-17-15-31(16-18-32)21-25-9-7-6-8-10-25/h6-14,27,33H,15-24H2,1-5H3 |
| InChIKey | RSFFWTLGRMOWDD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|