C22H30BrClN2O4 — CID 15945593
1-[2-(4-bromophenoxy)ethoxy]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride (PubChem CID 15945593) has the molecular formula C22H30BrClN2O4 and a molecular weight of 501.85 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethoxy]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(4-bromophenoxy)ethoxy]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 15945593 |
| Molecular Formula | C22H30BrClN2O4 |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethoxy]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CC(O)COCCOc2ccc(Br)cc2)CC1.Cl |
| InChI | InChI=1S/C22H29BrN2O4.ClH/c1-27-22-5-3-2-4-21(22)25-12-10-24(11-13-25)16-19(26)17-28-14-15-29-20-8-6-18(23)7-9-20;/h2-9,19,26H,10-17H2,1H3;1H |
| InChIKey | XMKINVMEVWRZJJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|