C17H27BrClNO3 — CID 12006100
1-[2-(4-bromophenoxy)ethoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride (PubChem CID 12006100) has the molecular formula C17H27BrClNO3 and a molecular weight of 408.76 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(4-bromophenoxy)ethoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 12006100 |
| Molecular Formula | C17H27BrClNO3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
| SMILES | CC1CCN(CC(O)COCCOc2ccc(Br)cc2)CC1.Cl |
| InChI | InChI=1S/C17H26BrNO3.ClH/c1-14-6-8-19(9-7-14)12-16(20)13-21-10-11-22-17-4-2-15(18)3-5-17;/h2-5,14,16,20H,6-13H2,1H3;1H |
| InChIKey | OZZWTPOBJKNRHJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|