C21H36NO2+ — CID 2359529
cyclohexyl-[(2R)-2-hydroxy-3-[4-(2-methylbutan-2-yl)phenoxy]propyl]-methylazanium (PubChem CID 2359529) has the molecular formula C21H36NO2+ and a molecular weight of 334.52 g/mol. Its IUPAC name is cyclohexyl-[(2R)-2-hydroxy-3-[4-(2-methylbutan-2-yl)phenoxy]propyl]-methylazanium.
| Compound Name | cyclohexyl-[(2R)-2-hydroxy-3-[4-(2-methylbutan-2-yl)phenoxy]propyl]-methylazanium |
|---|---|
| PubChem CID | 2359529 |
| Molecular Formula | C21H36NO2+ |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | cyclohexyl-[(2R)-2-hydroxy-3-[4-(2-methylbutan-2-yl)phenoxy]propyl]-methylazanium |
| SMILES | CCC(C)(C)c1ccc(OC[C@H](O)C[NH+](C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H35NO2/c1-5-21(2,3)17-11-13-20(14-12-17)24-16-19(23)15-22(4)18-9-7-6-8-10-18/h11-14,18-19,23H,5-10,15-16H2,1-4H3/p+1/t19-/m1/s1 |
| InChIKey | SYSFFVIMEVYQTI-LJQANCHMSA-O |
| XLogP | 2.96 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |