C16H27FN2O2+2 — CID 2409098
[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methyl-(1-methylpiperidin-1-ium-4-yl)azanium (PubChem CID 2409098) has the molecular formula C16H27FN2O2+2 and a molecular weight of 298.40 g/mol. Its IUPAC name is [(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methyl-(1-methylpiperidin-1-ium-4-yl)azanium.
| Compound Name | [(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
|---|---|
| PubChem CID | 2409098 |
| Molecular Formula | C16H27FN2O2+2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
| SMILES | C[NH+]1CCC([NH+](C)C[C@H](O)COc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H25FN2O2/c1-18-9-7-14(8-10-18)19(2)11-15(20)12-21-16-5-3-13(17)4-6-16/h3-6,14-15,20H,7-12H2,1-2H3/p+2/t15-/m0/s1 |
| InChIKey | WIWHWCVVMJFEBU-HNNXBMFYSA-P |
| XLogP | -1.24 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |