C12H17FO2 — CID 117241745
1-(4-fluorophenoxy)-4-methylpentan-2-ol (PubChem CID 117241745) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-4-methylpentan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 117241745 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(4-fluorophenoxy)-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FO2/c1-9(2)7-11(14)8-15-12-5-3-10(13)4-6-12/h3-6,9,11,14H,7-8H2,1-2H3 |
| InChIKey | BHHYORORVMGWIZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |