C13H18O4 — CID 164702579
(2R)-1-(1,3-benzodioxol-5-yloxy)-4-methylpentan-2-ol (PubChem CID 164702579) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2R)-1-(1,3-benzodioxol-5-yloxy)-4-methylpentan-2-ol.
| Compound Name | (2R)-1-(1,3-benzodioxol-5-yloxy)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 164702579 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R)-1-(1,3-benzodioxol-5-yloxy)-4-methylpentan-2-ol |
| SMILES | CC(C)C[C@@H](O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H18O4/c1-9(2)5-10(14)7-15-11-3-4-12-13(6-11)17-8-16-12/h3-4,6,9-10,14H,5,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | FWXCIWWRNQVGIG-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |