C16H24NO4+ — CID 2134526
(2S)-1-(azepan-1-ium-1-yl)-3-(1,3-benzodioxol-5-yloxy)propan-2-ol (PubChem CID 2134526) has the molecular formula C16H24NO4+ and a molecular weight of 294.37 g/mol. Its IUPAC name is (2S)-1-(azepan-1-ium-1-yl)-3-(1,3-benzodioxol-5-yloxy)propan-2-ol.
| Compound Name | (2S)-1-(azepan-1-ium-1-yl)-3-(1,3-benzodioxol-5-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 2134526 |
| Molecular Formula | C16H24NO4+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S)-1-(azepan-1-ium-1-yl)-3-(1,3-benzodioxol-5-yloxy)propan-2-ol |
| SMILES | O[C@H](COc1ccc2c(c1)OCO2)C[NH+]1CCCCCC1 |
| InChI | InChI=1S/C16H23NO4/c18-13(10-17-7-3-1-2-4-8-17)11-19-14-5-6-15-16(9-14)21-12-20-15/h5-6,9,13,18H,1-4,7-8,10-12H2/p+1/t13-/m0/s1 |
| InChIKey | YTDOLISAWCBDMP-ZDUSSCGKSA-O |
| XLogP | 0.61 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |