C15H22NO4+ — CID 2134518
(2S)-1-(1,3-benzodioxol-5-yloxy)-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 2134518) has the molecular formula C15H22NO4+ and a molecular weight of 280.34 g/mol. Its IUPAC name is (2S)-1-(1,3-benzodioxol-5-yloxy)-3-piperidin-1-ium-1-ylpropan-2-ol.
| Compound Name | (2S)-1-(1,3-benzodioxol-5-yloxy)-3-piperidin-1-ium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 2134518 |
| Molecular Formula | C15H22NO4+ |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2S)-1-(1,3-benzodioxol-5-yloxy)-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | O[C@H](COc1ccc2c(c1)OCO2)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C15H21NO4/c17-12(9-16-6-2-1-3-7-16)10-18-13-4-5-14-15(8-13)20-11-19-14/h4-5,8,12,17H,1-3,6-7,9-11H2/p+1/t12-/m0/s1 |
| InChIKey | ANFLPTDQGKPBFJ-LBPRGKRZSA-O |
| XLogP | 0.22 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |