C11H16BrN3O4 — CID 51131593
2-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]guanidine;hydrobromide (PubChem CID 51131593) has the molecular formula C11H16BrN3O4 and a molecular weight of 334.17 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]guanidine;hydrobromide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]guanidine;hydrobromide |
|---|---|
| PubChem CID | 51131593 |
| Molecular Formula | C11H16BrN3O4 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]guanidine;hydrobromide |
| SMILES | Br.NC(N)=NCC(O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15N3O4.BrH/c12-11(13)14-4-7(15)5-16-8-1-2-9-10(3-8)18-6-17-9;/h1-3,7,15H,4-6H2,(H4,12,13,14);1H |
| InChIKey | LNQVSRXJKHQYIV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|